CAS 152915-83-8 appears in our catalog under these names: 6-Benzyloxynaphthalene-2-boronic acid, 98%, 6-(Benzyloxy)-2-naphthylboronic acid, 97% , 6-Benzyloxy-2-naphthylboronic acid 98%, 6-Benzyloxy-2-naphthylboronic acid, 97%, 97%, 6-Benzyloxy-2-naphthylboronic acid, 97%. Offered by: Combi-blocks, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250MG.
(6-phenylmethoxynaphthalen-2-yl)boronic acid (CAS 152915-83-8) is a chemical compound with the molecular formula C17H15BO3 and a molecular weight of 278.1 g/mol. IUPAC name: (6-phenylmethoxynaphthalen-2-yl)boronic acid. InChIKey: ZVHAZMUBLCEMGG-UHFFFAOYSA-N.
| Molecular formula | C17H15BO3 |
|---|---|
| Molecular weight | 278.1 g/mol |
| IUPAC name | (6-phenylmethoxynaphthalen-2-yl)boronic acid |
| InChIKey | ZVHAZMUBLCEMGG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=C(C=C2)OCC3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)