CAS 871125-78-9 appears in our catalog under these names: 4-((1-Naphthyloxy)methyl)phenylboronic acid, 97%, (4-((Naphthalen-1-yloxy)methyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
[4-(naphthalen-1-yloxymethyl)phenyl]boronic acid (CAS 871125-78-9) is a chemical compound with the molecular formula C17H15BO3 and a molecular weight of 278.1 g/mol. IUPAC name: [4-(naphthalen-1-yloxymethyl)phenyl]boronic acid. InChIKey: ZYQMTIWKJLAEEF-UHFFFAOYSA-N.
| Molecular formula | C17H15BO3 |
|---|---|
| Molecular weight | 278.1 g/mol |
| IUPAC name | [4-(naphthalen-1-yloxymethyl)phenyl]boronic acid |
| InChIKey | ZYQMTIWKJLAEEF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)COC2=CC=CC3=CC=CC=C32)(O)O |
Computed by PubChem (NCBI)