CAS 1529654-75-8 is the registry number for 3-(2-Amino-6-bromo-3H-imidazo[4,5-b]pyridin-3-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-3-(1,1-dioxothiolan-3-yl)imidazo[4,5-b]pyridin-2-amine (CAS 1529654-75-8) is a chemical compound with the molecular formula C10H11BrN4O2S and a molecular weight of 331.19 g/mol. IUPAC name: 6-bromo-3-(1,1-dioxothiolan-3-yl)imidazo[4,5-b]pyridin-2-amine. InChIKey: QZIAPXAAZULPSO-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN4O2S |
|---|---|
| Molecular weight | 331.19 g/mol |
| IUPAC name | 6-bromo-3-(1,1-dioxothiolan-3-yl)imidazo[4,5-b]pyridin-2-amine |
| InChIKey | QZIAPXAAZULPSO-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C3=C(C=C(C=N3)Br)N=C2N |
Computed by PubChem (NCBI)