CAS 2680840-90-6 appears in our catalog under these names: tert-Butyl (6-bromothiazolo(4,5-b)pyrazin-2-yl)carbamate, 95%, tert-butyl N-{6-bromo-[1,3]thiazolo[4,5-b]pyrazin-2-yl}carbamate, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 25g, 1g, 5g, 10g, 100g.
Tert-butyl N-(6-bromo-[1,3]thiazolo[4,5-b]pyrazin-2-yl)carbamate (CAS 2680840-90-6) is a chemical compound with the molecular formula C10H11BrN4O2S and a molecular weight of 331.19 g/mol. IUPAC name: tert-butyl N-(6-bromo-[1,3]thiazolo[4,5-b]pyrazin-2-yl)carbamate. InChIKey: JTEMKUZWZQKSOB-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN4O2S |
|---|---|
| Molecular weight | 331.19 g/mol |
| IUPAC name | tert-butyl N-(6-bromo-[1,3]thiazolo[4,5-b]pyrazin-2-yl)carbamate |
| InChIKey | JTEMKUZWZQKSOB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC2=NC=C(N=C2S1)Br |
Computed by PubChem (NCBI)