CAS 1530-34-3 appears in our catalog under these names: (3-Methyl-2-butenyl)triphenyl-phosphonium Bromide, (3-Methyl-2-butenyl)triphenyl-phosphonium Bromide 95+%, (3-Methyl-2-butenyl)triphenyl-phosphonium Bromide, 98%, (3,3-Dimethylallyl)triphenylphosphonium bromide, 95%, (3,3–Dimethylallyl)triphenylphosphonium bromide. Offered by: TRC, Biosynth, Ambeed, Fluorochem, Combi-blocks. Available pack sizes: 1g, 500mg, 5g, 0,25g, 2,5g, 25g, 100g, 10g.
3-methylbut-2-enyl(triphenyl)phosphanium bromide (CAS 1530-34-3) is a chemical compound with the molecular formula C23H24BrP and a molecular weight of 411.3 g/mol. IUPAC name: 3-methylbut-2-enyl(triphenyl)phosphanium bromide. InChIKey: FTMCNCGWNJMMQS-UHFFFAOYSA-M.
| Molecular formula | C23H24BrP |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | 3-methylbut-2-enyl(triphenyl)phosphanium bromide |
| InChIKey | FTMCNCGWNJMMQS-UHFFFAOYSA-M |
| SMILES | CC(=CC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C.[Br-] |
Computed by PubChem (NCBI)