CAS 7333-52-0 appears in our catalog under these names: Cyclopentyltriphenylphosphonium bromide, 95%, Cyclopentyltriphenylphosphonium bromide/ 98+%, Cyclopentyltriphenylphosphonium bromide, Cyclopentyltriphenylphosphonium bromide, 96% , Cyclopentyltriphenylphosphonium bromide 98%. Offered by: Combi-blocks, Chemat, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed. Available pack sizes: 1g, 25g, 10g, 5g, 250g, 50g, 100g, 500g.
Cyclopentyl(triphenyl)phosphanium bromide (CAS 7333-52-0) is a chemical compound with the molecular formula C23H24BrP and a molecular weight of 411.3 g/mol. IUPAC name: cyclopentyl(triphenyl)phosphanium bromide. InChIKey: WZYWSVSFFTZZPE-UHFFFAOYSA-M.
| Molecular formula | C23H24BrP |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | cyclopentyl(triphenyl)phosphanium bromide |
| InChIKey | WZYWSVSFFTZZPE-UHFFFAOYSA-M |
| SMILES | C1CCC(C1)[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)