Products 1530799-71-3
CAS 1530799-71-3 is the registry number for 4-Amino-2-cyclopentylpyrimidine-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-amino-2-cyclopentylpyrimidine-5-carboxylic acid (CAS 1530799-71-3) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. IUPAC name: 4-amino-2-cyclopentylpyrimidine-5-carboxylic acid. InChIKey: XVHAGZGVAMSNJA-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O2 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 4-amino-2-cyclopentylpyrimidine-5-carboxylic acid |
| InChIKey | XVHAGZGVAMSNJA-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=NC=C(C(=N2)N)C(=O)O |
Computed by PubChem (NCBI)