CAS 153083-94-4 is the registry number for 1,2-dichloro-1,1,4,4,4-pentafluorobutane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1,2-dichloro-1,1,4,4,4-pentafluorobutane (CAS 153083-94-4) is a chemical compound with the molecular formula C4H3Cl2F5 and a molecular weight of 216.96 g/mol. IUPAC name: 1,2-dichloro-1,1,4,4,4-pentafluorobutane. InChIKey: FTPHAWKOBMZSCZ-UHFFFAOYSA-N.
| Molecular formula | C4H3Cl2F5 |
|---|---|
| Molecular weight | 216.96 g/mol |
| IUPAC name | 1,2-dichloro-1,1,4,4,4-pentafluorobutane |
| InChIKey | FTPHAWKOBMZSCZ-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)