CAS 70566-51-7 is the registry number for 4,4-Dichloro-1,1,1,3,3-pentafluorobutane, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
4,4-dichloro-1,1,1,3,3-pentafluorobutane (CAS 70566-51-7) is a chemical compound with the molecular formula C4H3Cl2F5 and a molecular weight of 216.96 g/mol. IUPAC name: 4,4-dichloro-1,1,1,3,3-pentafluorobutane. InChIKey: AMKQXWMMSDACQF-UHFFFAOYSA-N.
| Molecular formula | C4H3Cl2F5 |
|---|---|
| Molecular weight | 216.96 g/mol |
| IUPAC name | 4,4-dichloro-1,1,1,3,3-pentafluorobutane |
| InChIKey | AMKQXWMMSDACQF-UHFFFAOYSA-N |
| SMILES | C(C(C(Cl)Cl)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)