CAS 15311-09-8 appears in our catalog under these names: 2,5–Di(pyridin–4–yl)–1,3,4–thiadiazole, 2,5-Di(pyridin-4-yl)-1,3,4-thiadiazole, 95%, 95%, 2,5-Di(pyridin-4-yl)-1,3,4-thiadiazole, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
2,5-dipyridin-4-yl-1,3,4-thiadiazole (CAS 15311-09-8) is a chemical compound with the molecular formula C12H8N4S and a molecular weight of 240.29 g/mol. IUPAC name: 2,5-dipyridin-4-yl-1,3,4-thiadiazole. InChIKey: UQDBUNOBHAOPPJ-UHFFFAOYSA-N.
| Molecular formula | C12H8N4S |
|---|---|
| Molecular weight | 240.29 g/mol |
| IUPAC name | 2,5-dipyridin-4-yl-1,3,4-thiadiazole |
| InChIKey | UQDBUNOBHAOPPJ-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NN=C(S2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)