CAS 15362-52-4 appears in our catalog under these names: 2,5–Di(pyridin–3–yl)–1,3,4–thiadiazole, 2,5-Di(pyridin-3-yl)-1,3,4-thiadiazole, 97%, 97%, 2,5-Di(pyridin-3-yl)-1,3,4-thiadiazole, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g.
2,5-dipyridin-3-yl-1,3,4-thiadiazole (CAS 15362-52-4) is a chemical compound with the molecular formula C12H8N4S and a molecular weight of 240.29 g/mol. IUPAC name: 2,5-dipyridin-3-yl-1,3,4-thiadiazole. InChIKey: VEESCDPNZLKYDS-UHFFFAOYSA-N.
| Molecular formula | C12H8N4S |
|---|---|
| Molecular weight | 240.29 g/mol |
| IUPAC name | 2,5-dipyridin-3-yl-1,3,4-thiadiazole |
| InChIKey | VEESCDPNZLKYDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NN=C(S2)C3=CN=CC=C3 |
Computed by PubChem (NCBI)