Products 1531188-96-1
CAS 1531188-96-1 is the registry number for Ethyl 2-amino-1H-1,3-benzodiazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 2-amino-1H-benzimidazole-4-carboxylate (CAS 1531188-96-1) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: ethyl 2-amino-1H-benzimidazole-4-carboxylate. InChIKey: NFAQZLYBYSMEPE-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | ethyl 2-amino-1H-benzimidazole-4-carboxylate |
| InChIKey | NFAQZLYBYSMEPE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C(=CC=C1)NC(=N2)N |
Computed by PubChem (NCBI)