Products 153181-07-8
CAS 153181-07-8 is the registry number for (S)-2-Amino-3-(4-(trifluoromethyl)phenyl)propan-1-ol, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-3-[4-(trifluoromethyl)phenyl]propan-1-ol (CAS 153181-07-8) is a chemical compound with the molecular formula C10H12F3NO and a molecular weight of 219.20 g/mol. IUPAC name: (2S)-2-amino-3-[4-(trifluoromethyl)phenyl]propan-1-ol. InChIKey: UKNGRZBFRVEPGN-VIFPVBQESA-N.
| Molecular formula | C10H12F3NO |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-(trifluoromethyl)phenyl]propan-1-ol |
| InChIKey | UKNGRZBFRVEPGN-VIFPVBQESA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](CO)N)C(F)(F)F |
Computed by PubChem (NCBI)