Products 153203-80-6

CAS 153203-80-6 appears in our catalog under these names: 3,5-Dichloro-4-formylbenzoic acid, 97%, 3,5-Dichloro-4-formylbenzoic Acid, 3,5–Dichloro–4–formylbenzoic acid, 3,5-Dichloro-4-formylbenzoic Acid, >95.0%(GC)(T), 3,5-Dichloro-4-formylbenzoic acid 97%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 25g, 1g, 5g, 100mg, 500mg, 50mg, 10g, 250mg.

Structural formula: {0} (CAS {1})

3,5-dichloro-4-formylbenzoic acid (CAS 153203-80-6) is a chemical compound with the molecular formula C8H4Cl2O3 and a molecular weight of 219.02 g/mol. IUPAC name: 3,5-dichloro-4-formylbenzoic acid. InChIKey: KNZHVHRJCNWQKI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4Cl2O3
Molecular weight219.02 g/mol
IUPAC name3,5-dichloro-4-formylbenzoic acid
InChIKeyKNZHVHRJCNWQKI-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1Cl)C=O)Cl)C(=O)O

Computed by PubChem (NCBI)