CAS 1807998-43-1 appears in our catalog under these names: 2,6-Dichloro-4-formylbenzoic acid, 95%, 2,6-dichloro-4-formylbenzoic acid, 98%, 98%, 2,6-Dichloro-4-formylbenzoic acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 500mg.
2,6-dichloro-4-formylbenzoic acid (CAS 1807998-43-1) is a chemical compound with the molecular formula C8H4Cl2O3 and a molecular weight of 219.02 g/mol. IUPAC name: 2,6-dichloro-4-formylbenzoic acid. InChIKey: YXDBUOYLPATAFK-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2O3 |
|---|---|
| Molecular weight | 219.02 g/mol |
| IUPAC name | 2,6-dichloro-4-formylbenzoic acid |
| InChIKey | YXDBUOYLPATAFK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C(=O)O)Cl)C=O |
Computed by PubChem (NCBI)