Products 1807998-43-1

CAS 1807998-43-1 appears in our catalog under these names: 2,6-Dichloro-4-formylbenzoic acid, 95%, 2,6-dichloro-4-formylbenzoic acid, 98%, 98%, 2,6-Dichloro-4-formylbenzoic acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 500mg.

Structural formula: {0} (CAS {1})

2,6-dichloro-4-formylbenzoic acid (CAS 1807998-43-1) is a chemical compound with the molecular formula C8H4Cl2O3 and a molecular weight of 219.02 g/mol. IUPAC name: 2,6-dichloro-4-formylbenzoic acid. InChIKey: YXDBUOYLPATAFK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4Cl2O3
Molecular weight219.02 g/mol
IUPAC name2,6-dichloro-4-formylbenzoic acid
InChIKeyYXDBUOYLPATAFK-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1Cl)C(=O)O)Cl)C=O

Computed by PubChem (NCBI)