CAS 153295-35-3 appears in our catalog under these names: 2-Bromo-5-(4-fluorophenyl)pyrazine, 95%, 2–Bromo–5–(4–fluorophenyl)pyrazine, 2-Bromo-5-(4-fluorophenyl)pyrazine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-bromo-5-(4-fluorophenyl)pyrazine (CAS 153295-35-3) is a chemical compound with the molecular formula C10H6BrFN2 and a molecular weight of 253.07 g/mol. IUPAC name: 2-bromo-5-(4-fluorophenyl)pyrazine. InChIKey: PLPAAJCOMZOXAI-UHFFFAOYSA-N.
| Molecular formula | C10H6BrFN2 |
|---|---|
| Molecular weight | 253.07 g/mol |
| IUPAC name | 2-bromo-5-(4-fluorophenyl)pyrazine |
| InChIKey | PLPAAJCOMZOXAI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(C=N2)Br)F |
Computed by PubChem (NCBI)