CAS 85979-65-3 is the registry number for 4-Bromo-6-(4-fluorophenyl) Pyrimidine. Offered by: TRC. Available pack sizes: 1g.
4-bromo-6-(4-fluorophenyl)pyrimidine (CAS 85979-65-3) is a chemical compound with the molecular formula C10H6BrFN2 and a molecular weight of 253.07 g/mol. IUPAC name: 4-bromo-6-(4-fluorophenyl)pyrimidine. InChIKey: VVLXBRIIRDGDMQ-UHFFFAOYSA-N.
| Molecular formula | C10H6BrFN2 |
|---|---|
| Molecular weight | 253.07 g/mol |
| IUPAC name | 4-bromo-6-(4-fluorophenyl)pyrimidine |
| InChIKey | VVLXBRIIRDGDMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NC=N2)Br)F |
Computed by PubChem (NCBI)