CAS 153295-62-6 appears in our catalog under these names: 1,2-Bis(4-ethynylphenyl)ethyne, 98%, 98%, 1,2-Bis(4-ethynylphenyl)ethyne, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-ethynyl-4-[2-(4-ethynylphenyl)ethynyl]benzene (CAS 153295-62-6) is a chemical compound with the molecular formula C18H10 and a molecular weight of 226.3 g/mol. IUPAC name: 1-ethynyl-4-[2-(4-ethynylphenyl)ethynyl]benzene. InChIKey: TWIVNHSGJOJLJM-UHFFFAOYSA-N.
| Molecular formula | C18H10 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 1-ethynyl-4-[2-(4-ethynylphenyl)ethynyl]benzene |
| InChIKey | TWIVNHSGJOJLJM-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)C#CC2=CC=C(C=C2)C#C |
Computed by PubChem (NCBI)