CAS 34993-56-1 appears in our catalog under these names: 1-Ethynylpyrene, min. 95 %, 1 g, 1-Ethynylpyrene, 1–Ethynylpyrene, 1-Ethynylpyrene, 98%, 1-Ethynylpyrene, 98% . Offered by: Roth, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: 1g, 500mg, 10mg, 100mg, 50mg, 200mg, 5g, 10g.
1-ethynylpyrene (CAS 34993-56-1) is a chemical compound with the molecular formula C18H10 and a molecular weight of 226.3 g/mol. IUPAC name: 1-ethynylpyrene. InChIKey: VEBUBSLYGRMOSZ-UHFFFAOYSA-N.
| Molecular formula | C18H10 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 1-ethynylpyrene |
| InChIKey | VEBUBSLYGRMOSZ-UHFFFAOYSA-N |
| SMILES | C#CC1=C2C=CC3=CC=CC4=C3C2=C(C=C4)C=C1 |
Computed by PubChem (NCBI)