CAS 153341-23-2 appears in our catalog under these names: (S)-Sibutramine Hydrochloride, >95% (HPLC), (S)-Sibutramine hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg.
(1S)-1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrochloride (CAS 153341-23-2) is a chemical compound with the molecular formula C17H27Cl2N and a molecular weight of 316.3 g/mol. IUPAC name: (1S)-1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrochloride. InChIKey: UWAOJIWUVCMBAZ-NTISSMGPSA-N.
| Molecular formula | C17H27Cl2N |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | (1S)-1-[1-(4-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrochloride |
| InChIKey | UWAOJIWUVCMBAZ-NTISSMGPSA-N |
| SMILES | CC(C)C[C@@H](C1(CCC1)C2=CC=C(C=C2)Cl)N(C)C.Cl |
Computed by PubChem (NCBI)