CAS 153358-05-5 appears in our catalog under these names: 2-(Diphenylphosphino)benzaldehyde oxime, 96%, 2-(Diphenylphosphino)benzaldehyde oxime, 95% , 2-(Diphenylphosphino)benzaldehyde oxime, 98%, 98%, (E)-2-(Diphenylphosphanyl)benzaldehyde oxime, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
(NE)-N-[(2-diphenylphosphanylphenyl)methylidene]hydroxylamine (CAS 153358-05-5) is a chemical compound with the molecular formula C19H16NOP and a molecular weight of 305.3 g/mol. IUPAC name: (NE)-N-[(2-diphenylphosphanylphenyl)methylidene]hydroxylamine. InChIKey: XHIVESUSSLEMGJ-HMMYKYKNSA-N.
| Molecular formula | C19H16NOP |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | (NE)-N-[(2-diphenylphosphanylphenyl)methylidene]hydroxylamine |
| InChIKey | XHIVESUSSLEMGJ-HMMYKYKNSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3/C=N/O |
Computed by PubChem (NCBI)