Products 98837-46-8

CAS 98837-46-8 is the registry number for (E)-N-Benzylidene-P,P-diphenylphosphinic amide, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

N-diphenylphosphoryl-1-phenylmethanimine (CAS 98837-46-8) is a chemical compound with the molecular formula C19H16NOP and a molecular weight of 305.3 g/mol. IUPAC name: N-diphenylphosphoryl-1-phenylmethanimine. InChIKey: JLAOYBRAGQKVLX-UHFFFAOYSA-N.

Identity
Molecular formulaC19H16NOP
Molecular weight305.3 g/mol
IUPAC nameN-diphenylphosphoryl-1-phenylmethanimine
InChIKeyJLAOYBRAGQKVLX-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C=NP(=O)(C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)