Products 1534121-96-4

CAS 1534121-96-4 is the registry number for 3-Carbamoyl-4-fluorobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-carbamoyl-4-fluorobenzoic acid (CAS 1534121-96-4) is a chemical compound with the molecular formula C8H6FNO3 and a molecular weight of 183.14 g/mol. IUPAC name: 3-carbamoyl-4-fluorobenzoic acid. InChIKey: ZEPPHDDBCINTSE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6FNO3
Molecular weight183.14 g/mol
IUPAC name3-carbamoyl-4-fluorobenzoic acid
InChIKeyZEPPHDDBCINTSE-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)C(=O)N)F

Computed by PubChem (NCBI)