CAS 2304496-04-4 is the registry number for 5-Fluoro-6-nitro-1,3-dihydroisobenzofuran, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-6-nitro-1,3-dihydro-2-benzofuran (CAS 2304496-04-4) is a chemical compound with the molecular formula C8H6FNO3 and a molecular weight of 183.14 g/mol. IUPAC name: 5-fluoro-6-nitro-1,3-dihydro-2-benzofuran. InChIKey: GHJPBDMZXLUKEA-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO3 |
|---|---|
| Molecular weight | 183.14 g/mol |
| IUPAC name | 5-fluoro-6-nitro-1,3-dihydro-2-benzofuran |
| InChIKey | GHJPBDMZXLUKEA-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2CO1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)