Products 153437-52-6
CAS 153437-52-6 appears in our catalog under these names: 2-Amino-5-morpholinobenzoic acid, 95%, 2–Amino–5–morpholinobenzoic Acid, 2-Amino-5-morpholinobenzoic acid, 2-Amino-5-morpholinobenzoic acid, >95%, >95%, 2-Amino-5-(morpholin-4-yl)benzoic acid, >95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 0,5g, 10g.
2-amino-5-morpholin-4-ylbenzoic acid (CAS 153437-52-6) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: 2-amino-5-morpholin-4-ylbenzoic acid. InChIKey: HFHMPAKMODSNJN-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 2-amino-5-morpholin-4-ylbenzoic acid |
| InChIKey | HFHMPAKMODSNJN-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC(=C(C=C2)N)C(=O)O |
Computed by PubChem (NCBI)