CAS 153437-55-9 appears in our catalog under these names: WHI-P180 HCl, 98+%, WHI-P180 hydrochloride, WHI–P180 hydrochloride, WHI-P180 Hydrochloride, >97.0%(HPLC)(T), Whi-P180 Hydrochloride, ≥97%, ≥97%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: 5mg, 25mg, 50mg, 100mg, 10mg, 2mg, Get quote.
3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol;hydrochloride (CAS 153437-55-9) is a chemical compound with the molecular formula C16H16ClN3O3 and a molecular weight of 333.77 g/mol. IUPAC name: 3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol;hydrochloride. InChIKey: MJLLZROGIFJFJJ-UHFFFAOYSA-N.
| Molecular formula | C16H16ClN3O3 |
|---|---|
| Molecular weight | 333.77 g/mol |
| IUPAC name | 3-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol;hydrochloride |
| InChIKey | MJLLZROGIFJFJJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=CC=C3)O)OC.Cl |
Computed by PubChem (NCBI)