CAS 188829-39-2 is the registry number for JANEX-1 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol;hydrochloride (CAS 188829-39-2) is a chemical compound with the molecular formula C16H16ClN3O3 and a molecular weight of 333.77 g/mol. IUPAC name: 4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol;hydrochloride. InChIKey: HNJNNCPPISFBGR-UHFFFAOYSA-N.
| Molecular formula | C16H16ClN3O3 |
|---|---|
| Molecular weight | 333.77 g/mol |
| IUPAC name | 4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol;hydrochloride |
| InChIKey | HNJNNCPPISFBGR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=C(C=C3)O)OC.Cl |
Computed by PubChem (NCBI)