CAS 1534401-61-0 appears in our catalog under these names: Acetylfentanyl-d5, Acetylfentanyl-D5, 0.1mg/ml in Methanol, Acetylfentanyl-D5, 1mg/ml in Methanol, Acetyl Fentanyl–d5. Offered by: TRC, Lipomed, GLPBio. Available pack sizes: 25mg, 50mg, 100mg, 10mg, 1ml.
N-(2,3,4,5,6-pentadeuteriophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide (CAS 1534401-61-0) is a chemical compound with the molecular formula C21H26N2O and a molecular weight of 327.5 g/mol. IUPAC name: N-(2,3,4,5,6-pentadeuteriophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide. InChIKey: FYIUUQUPOKIKNI-LKOJFEAXSA-N.
| Molecular formula | C21H26N2O |
|---|---|
| Molecular weight | 327.5 g/mol |
| IUPAC name | N-(2,3,4,5,6-pentadeuteriophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide |
| InChIKey | FYIUUQUPOKIKNI-LKOJFEAXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N(C2CCN(CC2)CCC3=CC=CC=C3)C(=O)C)[2H])[2H] |
Computed by PubChem (NCBI)