CAS 153468-97-4 is the registry number for 2-(Difluoromethoxy)-3-fluoroaniline. Offered by: Fluorochem. Available pack sizes: 100mg.
2-(difluoromethoxy)-3-fluoroaniline (CAS 153468-97-4) is a chemical compound with the molecular formula C7H6F3NO and a molecular weight of 177.12 g/mol. IUPAC name: 2-(difluoromethoxy)-3-fluoroaniline. InChIKey: FGBYHDPFRBGTBB-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO |
|---|---|
| Molecular weight | 177.12 g/mol |
| IUPAC name | 2-(difluoromethoxy)-3-fluoroaniline |
| InChIKey | FGBYHDPFRBGTBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)OC(F)F)N |
Computed by PubChem (NCBI)