Products 1534688-50-0
CAS 1534688-50-0 appears in our catalog under these names: 5-Bromo-2-methyl-2h-indazole-3-carboxylic acid, 95%, 5-bromo-2-methyl-2H-indazole-3-carboxylic acid, 97%, 5-bromo-2-methyl-2h-indazole-3-carboxylic acid, 5-bromo-2-methyl-2H-indazole-3-carboxylicacid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 0,5g, 500mg, 10g.
5-bromo-2-methylindazole-3-carboxylic acid (CAS 1534688-50-0) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 5-bromo-2-methylindazole-3-carboxylic acid. InChIKey: FPDHDGSBPJCSOA-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 5-bromo-2-methylindazole-3-carboxylic acid |
| InChIKey | FPDHDGSBPJCSOA-UHFFFAOYSA-N |
| SMILES | CN1C(=C2C=C(C=CC2=N1)Br)C(=O)O |
Computed by PubChem (NCBI)