CAS 15352-77-9 is the registry number for beta-Bisabolol. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 25mg.
(1S)-4-methyl-1-[(2S)-6-methylhept-5-en-2-yl]cyclohex-3-en-1-ol (CAS 15352-77-9) is a chemical compound with the molecular formula C15H26O and a molecular weight of 222.37 g/mol. IUPAC name: (1S)-4-methyl-1-[(2S)-6-methylhept-5-en-2-yl]cyclohex-3-en-1-ol. InChIKey: WTVHAMTYZJGJLJ-LSDHHAIUSA-N.
| Molecular formula | C15H26O |
|---|---|
| Molecular weight | 222.37 g/mol |
| IUPAC name | (1S)-4-methyl-1-[(2S)-6-methylhept-5-en-2-yl]cyclohex-3-en-1-ol |
| InChIKey | WTVHAMTYZJGJLJ-LSDHHAIUSA-N |
| SMILES | CC1=CC[C@@](CC1)([C@@H](C)CCC=C(C)C)O |
Computed by PubChem (NCBI)