CAS 153545-97-2 is the registry number for (R)-Methyl 2-(p-Tolyloxy)propanoate. Offered by: TRC. Available pack sizes: 2,5g.
Methyl (2R)-2-(4-methylphenoxy)propanoate (CAS 153545-97-2) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: methyl (2R)-2-(4-methylphenoxy)propanoate. InChIKey: PPNXNYGZKHPNGV-SECBINFHSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | methyl (2R)-2-(4-methylphenoxy)propanoate |
| InChIKey | PPNXNYGZKHPNGV-SECBINFHSA-N |
| SMILES | CC1=CC=C(C=C1)O[C@H](C)C(=O)OC |
Computed by PubChem (NCBI)