CAS 153559-46-7 appears in our catalog under these names: 4-((5,6,7,8-Tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)carbonyl)benzoic Acid, >95% (HPLC), LG-100064/ 99.79% (existing batch purity), LG-100064 99%, 4-(3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydronaphthalene-2-carbonyl)benzoic acid, 99%, 99%, LG-100064, 99.55%. Offered by: TRC, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 5mg, 25mg, 200mg, 1mg, 250mg.
4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)benzoic acid (CAS 153559-46-7) is a chemical compound with the molecular formula C23H26O3 and a molecular weight of 350.4 g/mol. IUPAC name: 4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)benzoic acid. InChIKey: QADGBOQVBUXZKO-UHFFFAOYSA-N.
| Molecular formula | C23H26O3 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)benzoic acid |
| InChIKey | QADGBOQVBUXZKO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C(=O)C3=CC=C(C=C3)C(=O)O)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)