CAS 51186-88-0 appears in our catalog under these names: (+)-cis-Phenothrin, >95% (HPLC), (+)-Cis-phenothrin. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg, 25mg, 1mg, 5mg.
Trans-(3-phenoxyphenyl)methyl (1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate (CAS 51186-88-0) is a chemical compound with the molecular formula C23H26O3 and a molecular weight of 350.4 g/mol. IUPAC name: trans-(3-phenoxyphenyl)methyl (1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate. InChIKey: SBNFWQZLDJGRLK-SFTDATJTSA-N.
| Molecular formula | C23H26O3 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | trans-(3-phenoxyphenyl)methyl (1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| InChIKey | SBNFWQZLDJGRLK-SFTDATJTSA-N |
| SMILES | CC(=C[C@H]1[C@H](C1(C)C)C(=O)OCC2=CC(=CC=C2)OC3=CC=CC=C3)C |
Computed by PubChem (NCBI)