Products 153559-92-3
CAS 153559-92-3 is the registry number for 6-((3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydronaphthalen-2-yl)carbonyl) Nicotinic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 250mg, 25mg.
Methyl 6-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)pyridine-3-carboxylate (CAS 153559-92-3) is a chemical compound with the molecular formula C23H27NO3 and a molecular weight of 365.5 g/mol. IUPAC name: methyl 6-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)pyridine-3-carboxylate. InChIKey: YYRUFECVWILGJZ-UHFFFAOYSA-N.
| Molecular formula | C23H27NO3 |
|---|---|
| Molecular weight | 365.5 g/mol |
| IUPAC name | methyl 6-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)pyridine-3-carboxylate |
| InChIKey | YYRUFECVWILGJZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C(=O)C3=NC=C(C=C3)C(=O)OC)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)