CAS 873841-43-1 is the registry number for 2-(1-Hydroxypentyl)-6-methyl-3-(2-phenylethyl)-1H-indole-5-carboxylic Acid. Offered by: TRC. Available pack sizes: 250mg.
2-(1-hydroxypentyl)-6-methyl-3-(2-phenylethyl)-1H-indole-5-carboxylic acid (CAS 873841-43-1) is a chemical compound with the molecular formula C23H27NO3 and a molecular weight of 365.5 g/mol. IUPAC name: 2-(1-hydroxypentyl)-6-methyl-3-(2-phenylethyl)-1H-indole-5-carboxylic acid. InChIKey: CTHUKURTASAUTM-UHFFFAOYSA-N.
| Molecular formula | C23H27NO3 |
|---|---|
| Molecular weight | 365.5 g/mol |
| IUPAC name | 2-(1-hydroxypentyl)-6-methyl-3-(2-phenylethyl)-1H-indole-5-carboxylic acid |
| InChIKey | CTHUKURTASAUTM-UHFFFAOYSA-N |
| SMILES | CCCCC(C1=C(C2=C(N1)C=C(C(=C2)C(=O)O)C)CCC3=CC=CC=C3)O |
Computed by PubChem (NCBI)