Products 15356-62-4

CAS 15356-62-4 is the registry number for (-)-Menthoxyacetyl chloride, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetyl chloride (CAS 15356-62-4) is a chemical compound with the molecular formula C12H21ClO2 and a molecular weight of 232.74 g/mol. IUPAC name: 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetyl chloride. InChIKey: VNMCKLVHDJADEB-OUAUKWLOSA-N.

Identity
Molecular formulaC12H21ClO2
Molecular weight232.74 g/mol
IUPAC name2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetyl chloride
InChIKeyVNMCKLVHDJADEB-OUAUKWLOSA-N
SMILESC[C@@H]1CC[C@H]([C@@H](C1)OCC(=O)Cl)C(C)C

Computed by PubChem (NCBI)