CAS 15356-62-4 is the registry number for (-)-Menthoxyacetyl chloride, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetyl chloride (CAS 15356-62-4) is a chemical compound with the molecular formula C12H21ClO2 and a molecular weight of 232.74 g/mol. IUPAC name: 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetyl chloride. InChIKey: VNMCKLVHDJADEB-OUAUKWLOSA-N.
| Molecular formula | C12H21ClO2 |
|---|---|
| Molecular weight | 232.74 g/mol |
| IUPAC name | 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetyl chloride |
| InChIKey | VNMCKLVHDJADEB-OUAUKWLOSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OCC(=O)Cl)C(C)C |
Computed by PubChem (NCBI)