Products 21758-29-2

CAS 21758-29-2 is the registry number for Menthyl 2-chloroacetate, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-chloroacetate (CAS 21758-29-2) is a chemical compound with the molecular formula C12H21ClO2 and a molecular weight of 232.74 g/mol. IUPAC name: [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-chloroacetate. InChIKey: XHQPKRVACXDVNV-OUAUKWLOSA-N.

Identity
Molecular formulaC12H21ClO2
Molecular weight232.74 g/mol
IUPAC name[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-chloroacetate
InChIKeyXHQPKRVACXDVNV-OUAUKWLOSA-N
SMILESC[C@@H]1CC[C@H]([C@@H](C1)OC(=O)CCl)C(C)C

Computed by PubChem (NCBI)