CAS 153595-92-7 appears in our catalog under these names: 3-(indol-3-ylmethyl)-4-phenyl-1,2,4-triazoline-5-thione, 3-(Indol-3-ylmethyl)-4-phenyl-1,2,4-triazoline-5-thione, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 1g, 2g, 5g, 25g, 10g.
3-(1H-indol-3-ylmethyl)-4-phenyl-1H-1,2,4-triazole-5-thione (CAS 153595-92-7) is a chemical compound with the molecular formula C17H14N4S and a molecular weight of 306.4 g/mol. IUPAC name: 3-(1H-indol-3-ylmethyl)-4-phenyl-1H-1,2,4-triazole-5-thione. InChIKey: KWXJFDXNNYPOGY-UHFFFAOYSA-N.
| Molecular formula | C17H14N4S |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 3-(1H-indol-3-ylmethyl)-4-phenyl-1H-1,2,4-triazole-5-thione |
| InChIKey | KWXJFDXNNYPOGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NNC2=S)CC3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)