CAS 438030-31-0 appears in our catalog under these names: 5-(1H-Indol-3-yl)-4-m-tolyl-4h-[1,2,4]triazole-3-thiol, 95%, 5-(1H-Indol-3-yl)-4-(m-tolyl)-4H-1,2,4-triazole-3-thiol, 95%, 95%, 3-(1H-indol-3-yl)-4-(3-methylphenyl)-4,5-dihydro-1H-1,2,4-triazole-5-thione, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 500mg.
3-(1H-indol-3-yl)-4-(3-methylphenyl)-1H-1,2,4-triazole-5-thione (CAS 438030-31-0) is a chemical compound with the molecular formula C17H14N4S and a molecular weight of 306.4 g/mol. IUPAC name: 3-(1H-indol-3-yl)-4-(3-methylphenyl)-1H-1,2,4-triazole-5-thione. InChIKey: RTHYPKREPKNNCU-UHFFFAOYSA-N.
| Molecular formula | C17H14N4S |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 3-(1H-indol-3-yl)-4-(3-methylphenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | RTHYPKREPKNNCU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=NNC2=S)C3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)