Products 15360-02-8
CAS 15360-02-8 appears in our catalog under these names: 3-tert-Butoxybenzoic Acid, 3-tert-Butoxybenzoic Acid 98%, 3-tert-Butoxybenzoic Acid, 98%, 98%, 3-(tert-Butoxy)benzoic acid, ≥95%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g, 10g.
3-[(2-methylpropan-2-yl)oxy]benzoic acid (CAS 15360-02-8) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxy]benzoic acid. InChIKey: IURSJORDCNZJFE-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxy]benzoic acid |
| InChIKey | IURSJORDCNZJFE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(tert-butoxy)benzoic acid, 3-tert-Butoxybenzoic acid, 3-(tert-butoxy)benzenecarboxylic acid, 3-[(2-methylpropan-2-yl)oxy]benzoic acid, Benzoic acid, 3-(1,1-dimethylethoxy)-, m-tert-Butoxybenzoic acid, Benzoic acid, m-tert-butoxy-, 3-tert-ButoxybenzoicAcid, 3-tert-butoxy-benzoic acid, 3-tert-Butoxybenzoic acid #