CAS 153617-04-0 appears in our catalog under these names: 6-Chloro-2,3-bis(trifluoromethyl)pyridine, 95%, 6-Chloro-2,3-bis(trifluoromethyl)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-chloro-2,3-bis(trifluoromethyl)pyridine (CAS 153617-04-0) is a chemical compound with the molecular formula C7H2ClF6N and a molecular weight of 249.54 g/mol. IUPAC name: 6-chloro-2,3-bis(trifluoromethyl)pyridine. InChIKey: PBCADMHKCLFSJK-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF6N |
|---|---|
| Molecular weight | 249.54 g/mol |
| IUPAC name | 6-chloro-2,3-bis(trifluoromethyl)pyridine |
| InChIKey | PBCADMHKCLFSJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(F)(F)F)C(F)(F)F)Cl |
Computed by PubChem (NCBI)