CAS 175136-26-2 is the registry number for 2-Chloro-3,6-bis(trifluoromethyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-3,6-bis(trifluoromethyl)pyridine (CAS 175136-26-2) is a chemical compound with the molecular formula C7H2ClF6N and a molecular weight of 249.54 g/mol. IUPAC name: 2-chloro-3,6-bis(trifluoromethyl)pyridine. InChIKey: LXMMRMHPZYGFIA-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF6N |
|---|---|
| Molecular weight | 249.54 g/mol |
| IUPAC name | 2-chloro-3,6-bis(trifluoromethyl)pyridine |
| InChIKey | LXMMRMHPZYGFIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(F)(F)F)Cl)C(F)(F)F |
Computed by PubChem (NCBI)