Products 15366-65-1

CAS 15366-65-1 appears in our catalog under these names: 5–Iodonicotinic acid, 5-iodopyridine-3-carboxylic acid, 5-Iodonicotinic acid 95%, 5-Iodonicotinic Acid, 95+%, 95+%, 5-Iodonicotinic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 2,5g, 1g, 5g.

Structural formula: {0} (CAS {1})

5-iodopyridine-3-carboxylic acid (CAS 15366-65-1) is a chemical compound with the molecular formula C6H4INO2 and a molecular weight of 249.01 g/mol. IUPAC name: 5-iodopyridine-3-carboxylic acid. InChIKey: UPFHREFMESXXLW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4INO2
Molecular weight249.01 g/mol
IUPAC name5-iodopyridine-3-carboxylic acid
InChIKeyUPFHREFMESXXLW-UHFFFAOYSA-N
SMILESC1=C(C=NC=C1I)C(=O)O

Computed by PubChem (NCBI)