CAS 15371-15-0 appears in our catalog under these names: CHEMBRDG-BB 4023079, 1H-Purine-2,6-dione, 8-bromo-3,7-dihydro-3,7-dimethyl-, 97%, 97%, 8-Bromo-3,7-dimethyl-1H-purine-2,6(3H,7H)-dione, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
8-bromo-3,7-dimethylpurine-2,6-dione (CAS 15371-15-0) is a chemical compound with the molecular formula C7H7BrN4O2 and a molecular weight of 259.06 g/mol. IUPAC name: 8-bromo-3,7-dimethylpurine-2,6-dione. InChIKey: BFCGRDZSZWDOMD-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN4O2 |
|---|---|
| Molecular weight | 259.06 g/mol |
| IUPAC name | 8-bromo-3,7-dimethylpurine-2,6-dione |
| InChIKey | BFCGRDZSZWDOMD-UHFFFAOYSA-N |
| SMILES | CN1C2=C(N=C1Br)N(C(=O)NC2=O)C |
Computed by PubChem (NCBI)