CAS 1956321-69-9 appears in our catalog under these names: 6-Bromo-1-methyl-1h-imidazo[4,5-b]pyrazine formic acid, 95%, 6-Bromo-1-methyl-1H-imidazo(4,5-b)pyrazine formate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
5-bromo-3-methylimidazo[4,5-b]pyrazine;formic acid (CAS 1956321-69-9) is a chemical compound with the molecular formula C7H7BrN4O2 and a molecular weight of 259.06 g/mol. IUPAC name: 5-bromo-3-methylimidazo[4,5-b]pyrazine;formic acid. InChIKey: PRHIRHCQSMUSFZ-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN4O2 |
|---|---|
| Molecular weight | 259.06 g/mol |
| IUPAC name | 5-bromo-3-methylimidazo[4,5-b]pyrazine;formic acid |
| InChIKey | PRHIRHCQSMUSFZ-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=NC=C(N=C21)Br.C(=O)O |
Computed by PubChem (NCBI)