CAS 1537335-24-2 is the registry number for (1,3-Dimethyl-1H-indazol-6-yl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1,3-dimethylindazol-6-yl)methanamine (CAS 1537335-24-2) is a chemical compound with the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. IUPAC name: (1,3-dimethylindazol-6-yl)methanamine. InChIKey: RJONUANAPSUFFS-UHFFFAOYSA-N.
| Molecular formula | C10H13N3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | (1,3-dimethylindazol-6-yl)methanamine |
| InChIKey | RJONUANAPSUFFS-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=CC(=C2)CN)C |
Computed by PubChem (NCBI)