Products 1537889-10-3

CAS 1537889-10-3 is the registry number for JWH 398 N–pentanoic acid metabolite. Offered by: GLPBio. Available pack sizes: 10mg, 1mg, 5mg.

Structural formula: {0} (CAS {1})

5-[3-(4-chloronaphthalene-1-carbonyl)indol-1-yl]pentanoic acid (CAS 1537889-10-3) is a chemical compound with the molecular formula C24H20ClNO3 and a molecular weight of 405.9 g/mol. IUPAC name: 5-[3-(4-chloronaphthalene-1-carbonyl)indol-1-yl]pentanoic acid. InChIKey: VTGKQZQQXCKOOD-UHFFFAOYSA-N.

Identity
Molecular formulaC24H20ClNO3
Molecular weight405.9 g/mol
IUPAC name5-[3-(4-chloronaphthalene-1-carbonyl)indol-1-yl]pentanoic acid
InChIKeyVTGKQZQQXCKOOD-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CC=C2Cl)C(=O)C3=CN(C4=CC=CC=C43)CCCCC(=O)O

Computed by PubChem (NCBI)