Products 2749394-76-9
CAS 2749394-76-9 is the registry number for JWH 398 N–pentanoic acid metabolite–d5. Offered by: GLPBio. Available pack sizes: 1mg, 100μg, 500μg.
5-[3-(4-chloronaphthalene-1-carbonyl)-2,4,5,6,7-pentadeuterioindol-1-yl]pentanoic acid (CAS 2749394-76-9) is a chemical compound with the molecular formula C24H20ClNO3 and a molecular weight of 410.9 g/mol. IUPAC name: 5-[3-(4-chloronaphthalene-1-carbonyl)-2,4,5,6,7-pentadeuterioindol-1-yl]pentanoic acid. InChIKey: VTGKQZQQXCKOOD-SUBDTABOSA-N.
| Molecular formula | C24H20ClNO3 |
|---|---|
| Molecular weight | 410.9 g/mol |
| IUPAC name | 5-[3-(4-chloronaphthalene-1-carbonyl)-2,4,5,6,7-pentadeuterioindol-1-yl]pentanoic acid |
| InChIKey | VTGKQZQQXCKOOD-SUBDTABOSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCCCC(=O)O)[2H])C(=O)C3=CC=C(C4=CC=CC=C43)Cl)[2H])[2H] |
Computed by PubChem (NCBI)