Products 38953-70-7
CAS 38953-70-7 is the registry number for 1-(2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl)imidazole. Offered by: Biosynth. Available pack sizes: 1g.
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-imidazol-1-yloxan-2-yl]methyl acetate (CAS 38953-70-7) is a chemical compound with the molecular formula C17H22N2O9 and a molecular weight of 398.4 g/mol. IUPAC name: [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-imidazol-1-yloxan-2-yl]methyl acetate. InChIKey: WTICWOCDMOSFLJ-NQNKBUKLSA-N.
| Molecular formula | C17H22N2O9 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-imidazol-1-yloxan-2-yl]methyl acetate |
| InChIKey | WTICWOCDMOSFLJ-NQNKBUKLSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)N2C=CN=C2)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)